|
|
| | Sildenafil Chlorosulfonyl Basic information |
| Product Name: | Sildenafil Chlorosulfonyl | | Synonyms: | 3-(6,7-dihydro-1-methyl-7-oxo-3-propyl-1 H-pyrazolo-(4-3-d)-pyrimidine-5;3-(4,7-Dihydro-1-methyl-7-oxo-3-propyl-1H-pyrazolo[4,3-d]pyrimidin-5-yl)-4-ethoxy-benzenesulfonyl Chloride;5-(5-Chlorosulfonyl-2-ethoxyphenyl)-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one;5-(5-CHLOROSULFONYL-2-ETHOXY PHENYL)-1-METHYL-3-N-PROPYL-1;Sildenafil Chlorosulfonyl IMpurity;4-Ethoxy-3-(1-Methyl-7-oxo-3-propyl-6,7-dihydro-1H-pyrazolo[4,3-d]pyriMidin-5-yl)benzene-1-sulfonyl chloride;Sildenafil Chlorosulfone IMpurity;4-Ethoxy-3-(1-methyl-7-oxo-3-propyl-6,7-dihydro-1H-pyrazolo-[4,3-d]pyrimidin-5-yl)benzene-1-sulfo | | CAS: | 139756-22-2 | | MF: | C17H19ClN4O4S | | MW: | 410.88 | | EINECS: | | | Product Categories: | Bases & Related Reagents;Nucleotides;Sulfonyl Chlorides | | Mol File: | 139756-22-2.mol |  |
| | Sildenafil Chlorosulfonyl Chemical Properties |
| Melting point | 180-182°C | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 9.87±0.20(Predicted) | | color | White to Pale Beige | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C17H19ClN4O4S/c1-4-6-12-14-15(22(3)21-12)17(23)20-16(19-14)11-9-10(27(18,24)25)7-8-13(11)26-5-2/h7-9H,4-6H2,1-3H3,(H,19,20,23) | | InChIKey | RVVOSOSBFSYZDM-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=C(OCC)C(C2NC(=O)C3N(C)N=C(CCC)C=3N=2)=C1 | | CAS DataBase Reference | 139756-22-2 |
| | Sildenafil Chlorosulfonyl Usage And Synthesis |
| Description | Sildenafil chlorosulfonyl is a synthetic intermediate in the synthesis of the phosphodiesterase 5 (PDE5) inhibitor sildenafil. It is also a potential impurity found in commercial preparations of sildenafil. | | Chemical Properties | Off-White Solid | | Uses | The compound Sildenafil Chlorosulfonyl Impurity (139756-22-2) is a derivative of Sildenafil. It is widely used in the treatment of pulmonary hypertension as it is capable of inhibiting cGMP and acts as a potent selective inhibitor of PDE5. |
| | Sildenafil Chlorosulfonyl Preparation Products And Raw materials |
|