|
|
| | Potassium hydrogen phthalate Basic information |
| Product Name: | Potassium hydrogen phthalate | | Synonyms: | Phthalic acid, MonopotassiuM salt (8CI);potassiuM 2-carboxybenzoate;PotassiuM Biphthalate, Reagent, ACS;PotassiuM Hydrogen Phthalate, AcidiMetric Standard, Crystal, Reagent Special, ACS;ELECTRODE STORAGE SOLN;ELECTRODE STORAGE SOLUTION;Potassium hydrogen phthalate, acidimetric standard, 99.99%;CDKN3, GST tagged human | | CAS: | 877-24-7 | | MF: | C8H5KO4 | | MW: | 204.22 | | EINECS: | 212-889-4 | | Product Categories: | Analytical reagent;Classes of Metal Compounds;INORGANIC & ORGANIC CHEMICALS;K (Potassium) Compounds (excluding simple potassium salts);Typical Metal Compounds | | Mol File: | 877-24-7.mol |  |
| | Potassium hydrogen phthalate Chemical Properties |
| Melting point | 295-300 °C (dec.) (lit.) | | Boiling point | 98.5-99.5 ;°C/740 ;mmHg(lit .) | | density | 1.006 g/mL at 20 °C | | bulk density | 900kg/m3 | | storage temp. | Store at +5°C to +30°C. | | solubility | H2O: 100 mg/mL, clear, colorless | | form | Solid | | color | White | | PH | 4.00-4.02 (25.0℃±0.2℃, 0.05M) | | Odor | Odorless | | PH Range | 3.8 - 4.0 (5% aq. sol.) | | Water Solubility | 80 G/L (20 ºC) | | Merck | 14,7612 | | BRN | 3637128 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Cosmetics Ingredients Functions | BUFFERING | | InChI | 1S/C8H6O4.K/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1 | | InChIKey | IWZKICVEHNUQTL-UHFFFAOYSA-M | | SMILES | [K+].OC(=O)c1ccccc1C([O-])=O | | LogP | -2.73 | | CAS DataBase Reference | 877-24-7(CAS DataBase Reference) | | EPA Substance Registry System | Monopotassium phthalate (877-24-7) | | Absorption | cut-off at 309nm in H2O at 0.1M |
| | Potassium hydrogen phthalate Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Potassium hydrogen phthalate [KHP; pH(S) = 4.005 (25 °C)] is a certified secondary standard reference material used as a calibration buffer standard for pH instruments or pH electrodes. | | Uses | As a primary standard for preparing volumetric alkali solutions and as a buffer in pH determinations. Potassium hydrogen phthalate is used as a primary standard for acid- base titrations as well as for calibrating pH meters. It acts as a buffer in pH determination. It finds application as a useful standard for total organic carbon testing. | | Uses | As primary standard for preparing volumetric alkali solutions, also as a buffer in pH determinations. | | General Description | SRM 2185_cert SRM 2185 _SDS | | Flammability and Explosibility | Not classified | | Purification Methods | Crystallise it first from a dilute aqueous solution of K2CO3, then H2O (3mL/g) between 100o and 0o. Before being used as a standard in volumetric analysis, analytical grade potassium hydrogen phthalate should be dried at 120o for 2hours, then allowed to cool in a desiccator. [Beilstein 9 IV 3169.] |
| | Potassium hydrogen phthalate Preparation Products And Raw materials |
|