|
| 2-Bromo-5-methylbenzonitrile Basic information |
| 2-Bromo-5-methylbenzonitrile Chemical Properties |
Melting point | 61-65 °C | Boiling point | 290 °C | density | 1.51 | Fp | 129 °C | storage temp. | Inert atmosphere,Room Temperature | solubility | soluble in Methanol | form | Crystalline Powder | color | Off-white to pale yellow | InChI | InChI=1S/C8H6BrN/c1-6-2-3-8(9)7(4-6)5-10/h2-4H,1H3 | InChIKey | AKCXJAVATJLYQM-UHFFFAOYSA-N | SMILES | C(#N)C1=CC(C)=CC=C1Br | CAS DataBase Reference | 42872-83-3 |
Hazard Codes | Xn | Risk Statements | 22 | RIDADR | 3439 | WGK Germany | 3 | HazardClass | 6.1 | PackingGroup | III | HS Code | 2926907090 |
| 2-Bromo-5-methylbenzonitrile Usage And Synthesis |
Chemical Properties | off-white crystalline | Reactions | 2-Bromo-5-methylbenzonitrile is a quinazolinone that can be synthesized by reacting 2-bromotoluene with nitric acid. It is a substrate for the synthesis of other quinazolinones. |
| 2-Bromo-5-methylbenzonitrile Preparation Products And Raw materials |
|