|
|
| | 3-aminopiperidine-2,6-dione Basic information |
| Product Name: | 3-aminopiperidine-2,6-dione | | Synonyms: | 3-aminopiperidine-2,6-dione;2,6-Piperidinedione, 3-amino-;3-aminopiperidine-2,6-quinone;3-azanylpiperidine-2,6-dione;Glutamimide;3-Amino-2,6-piperidinedione;SKL584;alpha-Aminoglutarimide | | CAS: | 2353-44-8 | | MF: | C5H8N2O2 | | MW: | 128.13 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 2353-44-8.mol |  |
| | 3-aminopiperidine-2,6-dione Chemical Properties |
| Melting point | 142-143℃ | | Boiling point | 334.5±35.0 °C(Predicted) | | density | 1.243±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | PBS (pH 7.2): 10 mg/ml | | form | A crystalline solid | | pka | 11.15±0.40(Predicted) | | InChI | InChI=1S/C5H8N2O2/c6-3-1-2-4(8)7-5(3)9/h3H,1-2,6H2,(H,7,8,9) | | InChIKey | NPWMTBZSRRLQNJ-UHFFFAOYSA-N | | SMILES | N1C(=O)CCC(N)C1=O | | CAS DataBase Reference | 2353-44-8 |
| | 3-aminopiperidine-2,6-dione Usage And Synthesis |
| Uses | 3-Amino-piperidine-2,6-dione is used for studies on the hydrolytic degradation and primary metabolic pathway of thalidomide in animals and human liver microsomes. Thalidomide is a sedative drug used to treat morning sickness. | | Definition | ChEBI: A dicarboximide that is piperidine-2,6-dione substituted at position 3 by an amino group. |
| | 3-aminopiperidine-2,6-dione Preparation Products And Raw materials |
|