- Scandium(III) nitrate
-
- $1.00 / 1kg
-
2019-07-06
- CAS:13465-60-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: Customized
|
| | Scandium(III) nitrate Basic information | | Uses |
| Product Name: | Scandium(III) nitrate | | Synonyms: | SCANDIUM (III) NITRATE;scandium trinitrate;SCANDIUM (III) NITRATE PENTAHYDRATE (99.9%-SC) (REO);SCANDIUM (III) NITRATE, REACTON, 99.99% (REO);nitric acid, scandium salt;SCANDIUM(III) NITRATE PENTAHYDRATE: 99.9% (REO);Scandium Nitrate Tetrahydrate;Scandium(III) nitrate hydrate, REacton(R), 99.99% (REO) | | CAS: | 13465-60-6 | | MF: | HNO3Sc | | MW: | 107.97 | | EINECS: | 236-701-5 | | Product Categories: | metal nitrate salts | | Mol File: | 13465-60-6.mol |  |
| | Scandium(III) nitrate Chemical Properties |
| solubility | soluble in ethanol | | form | Crystalline | | color | White | | Water Solubility | anhydrous very soluble H2O, alcohol [MER06] | | Sensitive | Hygroscopic | | Merck | 14,8392 | | InChI | InChI=1S/HNO3.Sc/c2-1(3)4;/h(H,2,3,4); | | InChIKey | SPSBXWARWOLNDA-UHFFFAOYSA-N | | SMILES | N(O)(=O)=O.[Sc] | | CAS DataBase Reference | 13465-60-6 | | EPA Substance Registry System | Nitric acid, scandium(3+) salt (13465-60-6) |
| Risk Statements | 8-36/37/38 | | Safety Statements | 17-26-36/37/39 | | RIDADR | 1477 | | TSCA | TSCA listed | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 2834298000 |
| Provider | Language |
|
ALFA
| English |
| | Scandium(III) nitrate Usage And Synthesis |
| Uses | Scandium(III) nitrate is applied in optical coating, catalyst, electronic ceramics and laser industry, are also excellent precursors for production of ultra high purity compounds, catalysts, and nanoscale materials. According to a new research, it can also be used as crystal dopant.
| | Chemical Properties | white crystal(s) [STR93] |
| | Scandium(III) nitrate Preparation Products And Raw materials |
|