| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Acetic acid, ammonium salt-d7, 99 atom % D CAS:194787-05-8 Package:1GR, 5GR
|
| Company Name: |
Shandong Xiya Chemical Co., Ltd
|
| Tel: |
13355009207 13355009207 |
| Email: |
3007715519@qq.com |
| Products Intro: |
CAS:194787-05-8 Purity:98% Package:25g;100g;500g;1kg
|
| Company Name: |
Thermo Fisher Scientific
|
| Tel: |
800-810-5118 |
| Email: |
cnchemical@thermofisher.com |
| Products Intro: |
Product Name:Acetic acid, aMMoniuM salt-d7, 99 atoM % D CAS:194787-05-8 Package:5GR
|
|
| | AMMONIUM ACETATE-D7 Basic information |
| | AMMONIUM ACETATE-D7 Chemical Properties |
| Melting point | 110-112 °C (dec.) (lit.) | | solubility | Water (Slightly) | | form | Solid | | color | White | | Stability: | Hygroscopic | | InChI | 1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3/i1D3;/hD4 | | InChIKey | USFZMSVCRYTOJT-KYWLLVRESA-N | | SMILES | [2H]N([2H])[2H].[2H]OC(=O)C([2H])([2H])[2H] | | CAS DataBase Reference | 194787-05-8 | | CAS Number Unlabeled | 631-61-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29152900 | | Storage Class | 11 - Combustible Solids |
| | AMMONIUM ACETATE-D7 Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Ammonium Acetate-d7 (CAS# 194787-05-8) is a useful isotopically labeled research compound. |
| | AMMONIUM ACETATE-D7 Preparation Products And Raw materials |
|