|
|
| | Ethyl 2-(3-Formyl-4-hydroxyphenyl)-4-methylthiazole-5-carboxylate Basic information |
| Product Name: | Ethyl 2-(3-Formyl-4-hydroxyphenyl)-4-methylthiazole-5-carboxylate | | Synonyms: | ethyl 2-(3-formyl-4-hydroxyphenyl)-4-methyl thiazole-5-carboxylate;2-(3-Formyl-4-hydroxy-phenyl)-4-methyl-thiazole-5-carboxylic acid ethyl ester;Thiazolecarboxylicacid,2-(3-forMyl-4-hydroxyphenyl)-4-Methyl-,ethylester;5-carboxylato-1-ethyl-2-(3-forMyl-4-hydroxyphenyl)-4-Methyl-1H-1$l^{4},3-thiazol-1-yl;Ethyl 2-(3-forMyl-4-hydroxyphenyl)-4-Methyl-5-Thiazolecarboxylate;5-carboxylato-1-ethyl-2-(3-forMyl-4-h;5-Thiazolecarboxylicacid, 2-(3-forMyl-4-hydroxyphenyl)-4-Methyl-, ethyl ester;2-(3-formyl-4-hydroxyphenyl)-4-methyl thiazole-5-carboxylate | | CAS: | 161798-01-2 | | MF: | C14H13NO4S | | MW: | 291.32 | | EINECS: | 692-179-2 | | Product Categories: | Febuxostat intermediate;161798-01-2 | | Mol File: | 161798-01-2.mol |  |
| | Ethyl 2-(3-Formyl-4-hydroxyphenyl)-4-methylthiazole-5-carboxylate Chemical Properties |
| Melting point | 116 °C | | Boiling point | 446.7±55.0 °C(Predicted) | | density | 1.335 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.81±0.20(Predicted) | | color | Pale Yellow to Yellow | | InChI | InChI=1S/C14H13NO4S/c1-3-19-14(18)12-8(2)15-13(20-12)9-4-5-11(17)10(6-9)7-16/h4-7,17H,3H2,1-2H3 | | InChIKey | NJRGQNNSIAFIJC-UHFFFAOYSA-N | | SMILES | S1C(C(OCC)=O)=C(C)N=C1C1=CC=C(O)C(C=O)=C1 | | CAS DataBase Reference | 161798-01-2(CAS DataBase Reference) |
| | Ethyl 2-(3-Formyl-4-hydroxyphenyl)-4-methylthiazole-5-carboxylate Usage And Synthesis |
| Description | Ethyl 2-(3-formyl-4-hydroxyphenyl)-4-methyl thiazole-5-carboxylate is a pharmaceutical intermediate used in the preparation of the xanthine oxidase inhibitor febuxostat, which is used in the treatment of hyperuricaemia and gout. It is also used in the synthesis of novel thiazolyl α-aminophosphonates. | | Chemical Properties | Yellow or yellow powder | | Uses | Ethyl 2-(3-Formyl-4-hydroxyphenyl)-4-methylthiazole-5-carboxylate is a product prepared via reaction 4-Hydroxybenzene-1-benzothiomide with ethyl-2-chloro acetoacetate. An antibacterial agent and antifungal activity against C.albicans. |
| | Ethyl 2-(3-Formyl-4-hydroxyphenyl)-4-methylthiazole-5-carboxylate Preparation Products And Raw materials |
|