| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:n-Pentane-d{12}, 98%(Isotopic) CAS:2031-90-5 Package:1g Remarks:042340
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:n-Pentane-d12, 98%(Isotopic) CAS:2031-90-5 Package:1g,5g
|
|
| | N-PENTANE-D12 Basic information |
| | N-PENTANE-D12 Chemical Properties |
| Melting point | −130 °C(lit.) | | Boiling point | 36 °C(lit.) | | density | 0.731 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.358(lit.) | | Fp | <−30 °F | | solubility | Chloroform (Sparingly), Hexane (Slightly) | | form | Liquid | | Sensitive | Light Sensitive | | Stability: | Volatile | | InChI | 1S/C5H12/c1-3-5-4-2/h3-5H2,1-2H3/i1D3,2D3,3D2,4D2,5D2 | | InChIKey | OFBQJSOFQDEBGM-HYVJACIRSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] | | CAS DataBase Reference | 2031-90-5 | | CAS Number Unlabeled | 109-66-0 |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 9-16-29-33 | | RIDADR | UN 1265 3/PG 2 | | WGK Germany | 3 | | TSCA | Yes | | HazardClass | 3 | | PackingGroup | II | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Asp. Tox. 1 Flam. Liq. 2 STOT SE 3 |
| | N-PENTANE-D12 Usage And Synthesis |
| Uses | Pentane-d12 is a deuterated NMR solvent useful in NMR-based research and analyses. | | General Description | Pentane-d12 is a deuterated NMR solvent useful in NMR-based research and analyses. |
| | N-PENTANE-D12 Preparation Products And Raw materials |
|