|
|
| | Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) Basic information |
| | Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) Chemical Properties |
| Melting point | 219-225 °C | | storage temp. | -20°C | | solubility | sol nonprotic solvents | | form | Powder | | color | orange | | Water Solubility | insoluble | | Sensitive | Air Sensitive | | InChI | InChI=1S/2C26H24P2.Pd/c2*1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h2*1-20H,21-22H2; | | InChIKey | UTBLWXFSGOYWOH-UHFFFAOYSA-R | | SMILES | P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)(C1C=CC=CC=1)C1=CC=CC=C1.P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1.[Pd] | | CAS DataBase Reference | 31277-98-2 |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36-37/39-26 | | RIDADR | 1479 | | WGK Germany | 3 | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) Usage And Synthesis |
| Chemical Properties | yellow to orange crystalline powder | | Uses | Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) is a homogeneous catalyst most widely used in allylic substitution reactions; good catalyst for bulky substrates; slowly dissociating ligand that gives good stereoselectivity. | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst | | storage | air and light sensitive. If stored under nitrogen or argon it is stable for about one month. Avoid inhalation. Use in a fume hood. | | Purification Methods | Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) can be recrystallized from benzene-ethanol or ethanol. |
| | Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) Preparation Products And Raw materials |
|