| Company Name: |
Guangzhou Isun Pharmaceutical Co., Ltd
|
| Tel: |
020-39119399 18927568969 |
| Email: |
isunpharm@qq.com |
| Products Intro: |
Product Name:Chorismic acid barium salt from Enterobacter aerogenes
CAS:55508-12-8
Purity:70%(HPLC) Package:5MG; 25MG; 100MG; 1G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:Chorismic acid barium salt from Enterobacter aerogenes >=55%
CAS:55508-12-8
Purity:NULL Package:100mg;25mg Remarks:NULL
|
| Company Name: |
Hubei CuiRan Biotechnology Co., Ltd.
|
| Tel: |
00-1816279-5156 18162795156 |
| Email: |
3391961471@qq.com |
| Products Intro: |
Product Name:Chorismic acid barium salt
CAS:55508-12-8
Purity:HPLC>=98% Package:5mg;100mg;500mg;1g
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Chorismic acid barium salt from Enterobacter aerogenes
CAS:55508-12-8
|
|
| | CHORISMIC ACID BARIUM SALT Basic information |
| Product Name: | CHORISMIC ACID BARIUM SALT | | Synonyms: | TRANS-3-[(1-CARBOXYETHENYL)OXY]-4-HYDROXY-1,5-CYCLOHEXADIENE-1-CARBOXYLIC ACID BARIUM SALT;chorismic acid barium;Chorismic acid barium salt from Enterobacter aerogenes;CHORISMIC ACID BARIUM SALT;Chorismic acid barium salt from Enterobacter aerogenes >=55%;Chorismic acid barium salt from Enterobacter aerogenes | | CAS: | 55508-12-8 | | MF: | C10H8BaO6 | | MW: | 361.49 | | EINECS: | | | Product Categories: | | | Mol File: | 55508-12-8.mol |  |
| | CHORISMIC ACID BARIUM SALT Chemical Properties |
| storage temp. | −70°C | | form | powder | | InChI | 1S/C10H10O6.Ba.2H/c1-5(9(12)13)16-8-4-6(10(14)15)2-3-7(8)11;;;/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15);;;/t7-,8-;;;/m1.../s1 | | InChIKey | JFTBXNPYKNMOHD-MVYICHOISA-N | | SMILES | [Ba].O[C@@H]1C=CC(=C[C@H]1OC(=C)C(O)=O)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 2
STOT SE 3 |
| | CHORISMIC ACID BARIUM SALT Usage And Synthesis |
| Uses | Chorismic acid is used as a precursor for a number of important biological compounds synthesized via the shikimate pathway such as the aromatic amino acids tyrosine and phenylalanine, indole, ubiquinone, 2,3-dihydroxybenzoic acid (DHB), and para-aminobenzoate (pABA).', 'Intermediate in the biosynthesis of aromatic amino acids via the shikimate pathway. |
| | CHORISMIC ACID BARIUM SALT Preparation Products And Raw materials |
|