|
| 3,6-Diazabicyclo[3.1.1]heptane-6-carboxylic acid tert-butyl ester Basic information |
Product Name: | 3,6-Diazabicyclo[3.1.1]heptane-6-carboxylic acid tert-butyl ester | Synonyms: | 3,6-Diazabicyclo[3.1.1]heptane-6-carboxylic acid tert-butyl ester;6-(tert-Butyloxycarbonyl)-3,6-diazabicyclo[3.1.1]heptane;(1R,5S)-tert-butyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate;3,6-Diazabicyclo[3.1.1]heptane-6-carboxylic acid, 1,1-dimethylethyl ester;tert-Butyl (1S,5R)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate;6-Boc-3,6-diaza-bicyclo[3.1.1]heptane;3,?6-?Diazabicyclo[3.1.1]?heptane-?6-?carboxylic acid, 1,?1-?dimethylethyl ester
869494-16-6;tert-Butyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate 97% | CAS: | 869494-16-6 | MF: | C10H18N2O2 | MW: | 198.26 | EINECS: | | Product Categories: | | Mol File: | 869494-16-6.mol | |
| 3,6-Diazabicyclo[3.1.1]heptane-6-carboxylic acid tert-butyl ester Chemical Properties |
Boiling point | 276℃ | density | 1.104 | Fp | 121℃ | storage temp. | 2-8°C(protect from light) | pka | 9.53±0.20(Predicted) | form | solid | color | White to off-white | InChI | InChI=1S/C10H18N2O2/c1-10(2,3)14-9(13)12-7-4-8(12)6-11-5-7/h7-8,11H,4-6H2,1-3H3 | InChIKey | OUFBVDKNEWUFHP-UHFFFAOYSA-N | SMILES | C12CC(N1C(OC(C)(C)C)=O)CNC2 |
| 3,6-Diazabicyclo[3.1.1]heptane-6-carboxylic acid tert-butyl ester Usage And Synthesis |
| 3,6-Diazabicyclo[3.1.1]heptane-6-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|