- 2-Chloro-6-fluorotoluene
-
- $9.00 / 1KG
-
2025-09-25
- CAS:443-83-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Chloro-6-fluorotoluene Basic information |
| | 2-Chloro-6-fluorotoluene Chemical Properties |
| Boiling point | 154-156 °C (lit.) | | density | 1.191 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.504(lit.) | | Fp | 115 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.191 | | Water Solubility | Insoluble | | BRN | 1932657 | | InChI | InChI=1S/C7H6ClF/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 | | InChIKey | FNPVYRJTBXHIPB-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(F)=C1C | | LogP | 3.39 | | CAS DataBase Reference | 443-83-4(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-chloro-3-fluoro-2-methyl-(443-83-4) | | EPA Substance Registry System | 2-Chloro-6-fluorotoluene (443-83-4) |
| Hazard Codes | Xn,F,Xi | | Risk Statements | 10-20/21/22-36/37/38 | | Safety Statements | 36/37-37/39-26-16-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 2 | | Hazard Note | Irritant/Flammable | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 2-Chloro-6-fluorotoluene Usage And Synthesis |
| Chemical Properties | colorless to light yellow liqui | | Uses | 2-Chloro-6-fluorotoluene reaction with SO− -4 has been studied by pulse radiolysis. | | General Description | 2-Chloro-6-fluorotoluene reaction with SO -4 has been studied by pulse radiolysis. |
| | 2-Chloro-6-fluorotoluene Preparation Products And Raw materials |
|