|
|
| | Biphenyl-3,4′,5-tricarboxylic acid Basic information |
| Product Name: | Biphenyl-3,4′,5-tricarboxylic acid | | Synonyms: | Biphenyl-3,4′,5-tricarboxylic acid;Biphenyl-3,4',5-tricarboxylic acid 96%;5-(4-carboxyphenyl)benzene-1,3-dicarboxylicacid;[1,1'-biphenyl]-3,4',5-tricarboxylic acid;3,5,4'-Biphenyltricarboxylic acid;DK7250;DK7526;1,1'-Biphenyl]-3,4',5-tricarboxylic acid | | CAS: | 677010-20-7 | | MF: | C15H10O6 | | MW: | 286.24 | | EINECS: | | | Product Categories: | MOFS COFS | | Mol File: | 677010-20-7.mol |  |
| | Biphenyl-3,4′,5-tricarboxylic acid Chemical Properties |
| Melting point | >300°C | | Boiling point | 627.7±55.0 °C(Predicted) | | density | 1.488±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.36±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C15H10O6/c16-13(17)9-3-1-8(2-4-9)10-5-11(14(18)19)7-12(6-10)15(20)21/h1-7H,(H,16,17)(H,18,19)(H,20,21) | | InChIKey | LQEZHWGJSWHXPJ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C(O)=O)C=C2)=CC(C(O)=O)=CC(C(O)=O)=C1 |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-50 | | Safety Statements | 26-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2917.39.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Biphenyl-3,4′,5-tricarboxylic acid Usage And Synthesis |
| | Biphenyl-3,4′,5-tricarboxylic acid Preparation Products And Raw materials |
|