|
|
| | 3-HYDROXY-4-METHYL-2-NITROBENZOIC ACID Basic information |
| | 3-HYDROXY-4-METHYL-2-NITROBENZOIC ACID Chemical Properties |
| Melting point | 185-187 °C (lit.) | | Boiling point | 379.7±42.0 °C(Predicted) | | density | 1.534±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.24±0.25(Predicted) | | Appearance | Light yellow to yellow Solid | | Optical Rotation | 0.2344°(C=1.0026g/100ml CHCL3) | | InChI | 1S/C8H7NO5/c1-4-2-3-5(8(11)12)6(7(4)10)9(13)14/h2-3,10H,1H3,(H,11,12) | | InChIKey | HEKGHQKEERXLOI-UHFFFAOYSA-N | | SMILES | Cc1ccc(C(O)=O)c(c1O)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-HYDROXY-4-METHYL-2-NITROBENZOIC ACID Usage And Synthesis |
| | 3-HYDROXY-4-METHYL-2-NITROBENZOIC ACID Preparation Products And Raw materials |
|