|
| 2-Chloro-4-fluoro-5-nitrophenol Basic information |
| 2-Chloro-4-fluoro-5-nitrophenol Chemical Properties |
Melting point | 105-108°C | Boiling point | 298.7±40.0 °C(Predicted) | density | 1.653±0.06 g/cm3(Predicted) | storage temp. | Inert atmosphere,Room Temperature | solubility | Methanol[soluble in] | solubility | soluble in Methanol | form | powder to crystal | pka | 6.58±0.24(Predicted) | color | Light orange to Yellow to Green | InChI | InChI=1S/C6H3ClFNO3/c7-3-1-4(8)5(9(11)12)2-6(3)10/h1-2,10H | InChIKey | NAWVMCKMQMJQMF-UHFFFAOYSA-N | SMILES | C1(O)=CC([N+]([O-])=O)=C(F)C=C1Cl | CAS DataBase Reference | 84478-75-1(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36/37/39 | HazardClass | IRRITANT | HS Code | 2908990000 |
| 2-Chloro-4-fluoro-5-nitrophenol Usage And Synthesis |
| 2-Chloro-4-fluoro-5-nitrophenol Preparation Products And Raw materials |
|