- 2,3,5,6-Tetrabromo-p-xylene
-
- $101.00 / 1KG
-
2023-12-29
- CAS:23488-38-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,3,5,6-Tetrabromo-p-xylene Basic information |
| Product Name: | 2,3,5,6-Tetrabromo-p-xylene | | Synonyms: | 1,4-Dimethyl-2,3,5,6-tetrabromobenzene;3,6-Dimethyl-1,2,4,5-tetrabromobenzene, 2,3,5,6-Tetrabromo-p-xylene;2,3,5,6-tetrabroMo-para-xylene;2,3,5,6-TETRABROMO-P-XYLENE;2,3,5,6-TETRABROMO-1,4-DIMETHYLBENZENE;1,2,4,5-tetrabormo-3,6-dimethyl-benzen;1,2,4,5-tetrabromo-3,6-dimethyl-benzen;1,4-Bis(dibrommethyl)benzen | | CAS: | 23488-38-2 | | MF: | C8H6Br4 | | MW: | 421.75 | | EINECS: | 245-688-5 | | Product Categories: | Aryl;C8;Halogenated Hydrocarbons | | Mol File: | 23488-38-2.mol |  |
| | 2,3,5,6-Tetrabromo-p-xylene Chemical Properties |
| Melting point | 254-256 °C(lit.) | | Boiling point | 303.01°C (rough estimate) | | density | 2.258 | | refractive index | 1.7040 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) | | form | Solid | | color | Off-White | | InChI | InChI=1S/C8H6Br4/c1-3-5(9)7(11)4(2)8(12)6(3)10/h1-2H3 | | InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N | | SMILES | C1(Br)=C(C)C(Br)=C(Br)C(C)=C1Br | | EPA Substance Registry System | 2,3,5,6-Tetrabromo-p-xylene (23488-38-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 1759 | | WGK Germany | 3 | | RTECS | ZE5170000 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2903998090 |
| | 2,3,5,6-Tetrabromo-p-xylene Usage And Synthesis |
| Uses | 2,3,5,6-Tetrabromo-p-xylene is a novel chemical flame retardant which may act as an environmental pollutant and contaminant such as within the endangered European eel (Anguilla anguilla) species. |
| | 2,3,5,6-Tetrabromo-p-xylene Preparation Products And Raw materials |
|