| Company Name: |
Wuhu Huaren Science and Technology Co., Ltd.
|
| Tel: |
0553-0553-0553-5842013-801-801 18155347026 |
| Email: |
jinhuaren@huarensh.com |
| Products Intro: |
Product Name:5-ap-dCTP
CAS:115899-39-3
Purity:97%HPLC Package:1g;5g;10g
|
| Company Name: |
Tianjin Scaxchem Limited Compnay
|
| Tel: |
022-022-25327698 18920479040 |
| Email: |
sales@cosychem.com |
| Products Intro: |
Product Name:5-Propargylamino-dCTP
Purity:90% Package:10ul (100 mM)；50ul (100 mM)；100ul (100 mM)
|
5-Propargylamino-dCTP manufacturers
|
| | 5-Propargylamino-dCTP Basic information |
| Product Name: | 5-Propargylamino-dCTP | | Synonyms: | ap-dCTP;5-(3-Amino-1-propyn-1-yl)-2'-deoxycytidine 5'-(tetrahydrogen triphosphate);5-ap-2'-dCTP·xTEA, 100mM solution;5-Propargylamino-2'-deoxycytidine-5'-triphosphate, sodium salt solution;Cytidine 5'-(tetrahydrogen triphosphate),5-(3-amino-1-propynyl)-2'-deoxy-;5-Propargylamino-dCTP;5-Propargylamino-dCTP - solution;Cytidine 5'-(tetrahydrogen triphosphate), 5-(3-amino-1-propyn-1-yl)-2'-deoxy- | | CAS: | 115899-39-3 | | MF: | C12H19N4O13P3 | | MW: | 520.22 | | EINECS: | | | Product Categories: | | | Mol File: | 115899-39-3.mol |  |
| | 5-Propargylamino-dCTP Chemical Properties |
| Boiling point | 836.0±75.0 °C(Predicted) | | density | 2.16±0.1 g/cm3(Predicted) | | pka | 0.97±0.50(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | LVTQIVFSMGDIPF-IVZWLZJFSA-N | | SMILES | C(OP(=O)(O)OP(O)(=O)OP(O)(O)=O)[C@H]1O[C@@H](N2C=C(C#CCN)C(N)=NC2=O)C[C@@H]1O |
| | 5-Propargylamino-dCTP Usage And Synthesis |
| Description | 5-Propargylamino-dCTP is a nucleoside molecule extracted from patent US9035035B2, compound dCTP-PA. 5-Propargylamino-dCTP can conjugate to molecular markers for use in nucleic acid labeling or sequence analysis. 5-Propargylamino-dCTP is a click chemistry reagent, itcontains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| | 5-Propargylamino-dCTP Preparation Products And Raw materials |
|