|
| 2-FLUORO-6-METHOXYANILINE Basic information |
Product Name: | 2-FLUORO-6-METHOXYANILINE | Synonyms: | 2-FLUORO-6-METHOXYANILINE;2-fluoro-6-methoxybenzenamine;2-Amino-3-fluoroanisole, 6-Fluoro-o-anisidine;2-AMino-3-fluoroanisole[2-Fluoro-6-Methoxyaniline];2-Fluoro-6-methoxy-phenylamine;-FLUORO-6-METHOXYANILINE;Benzenamine, 2-fluoro-6-methoxy- | CAS: | 446-61-7 | MF: | C7H8FNO | MW: | 141.14 | EINECS: | | Product Categories: | | Mol File: | 446-61-7.mol | |
| 2-FLUORO-6-METHOXYANILINE Chemical Properties |
Boiling point | 208 °C(Press: 756 Torr) | density | 1.176±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | pka | 3.15±0.10(Predicted) | form | slightly viscous liquid | color | Clear, peach/khaki | InChI | InChI=1S/C7H8FNO/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,9H2,1H3 | InChIKey | VHHKZASLPJMWJI-UHFFFAOYSA-N | SMILES | C1(N)=C(OC)C=CC=C1F |
Hazard Codes | Xi,Xn | Risk Statements | 22 | Hazard Note | Irritant | HS Code | 2922290090 |
| 2-FLUORO-6-METHOXYANILINE Usage And Synthesis |
Chemical Properties | black liquid |
| 2-FLUORO-6-METHOXYANILINE Preparation Products And Raw materials |
|