|
|
| | 1-(3-Oxetanyl)-1H-pyrazole-5-boronic acid pinacol ester Basic information |
| Product Name: | 1-(3-Oxetanyl)-1H-pyrazole-5-boronic acid pinacol ester | | Synonyms: | 1-(oxetan-3-yl)-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;1-(oxetan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;1H-Pyrazole, 1-(3-oxetanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;1-(3-Oxetanyl)pyrazole-5-boronic Acid Pinacol Ester;1-(3-Oxetanyl)-1H-pyrazole-5-boronic acid pinacol ester - [O8591] | | CAS: | 1876473-44-7 | | MF: | C12H19BN2O3 | | MW: | 250.1 | | EINECS: | | | Product Categories: | | | Mol File: | 1876473-44-7.mol |  |
| | 1-(3-Oxetanyl)-1H-pyrazole-5-boronic acid pinacol ester Chemical Properties |
| Boiling point | 384.7±32.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 2.26±0.19(Predicted) | | Appearance | white to pink solid | | InChI | InChI=1S/C12H19BN2O3/c1-11(2)12(3,4)18-13(17-11)10-5-6-14-15(10)9-7-16-8-9/h5-6,9H,7-8H2,1-4H3 | | InChIKey | VHNCSHVEKCWKMA-UHFFFAOYSA-N | | SMILES | N1(C2COC2)C(B2OC(C)(C)C(C)(C)O2)=CC=N1 |
| | 1-(3-Oxetanyl)-1H-pyrazole-5-boronic acid pinacol ester Usage And Synthesis |
| | 1-(3-Oxetanyl)-1H-pyrazole-5-boronic acid pinacol ester Preparation Products And Raw materials |
|