- Quininic acid
-
- $30.00 / 25mg
-
2025-11-05
- CAS:86-68-0
- Min. Order:
- Purity: 99.89%
- Supply Ability: 10g
- Quininic acid
-
- $30.00 / 25mg
-
2025-11-05
- CAS:86-68-0
- Min. Order:
- Purity: 99.89%
- Supply Ability: 10g
|
| Product Name: | QUININIC ACID | | Synonyms: | QUININIC ACID;6-METHOXY-4-QUINOLINECARBOXYLIC ACID;6-METHOXYQUINOLINE-4-CARBOXYLIC ACID;Cinchoninic Acid, 6-methoxy-;Nsc 403610;6-Methoxyquinoline-4-carboxylicAcid>;4-Quinolinecarboxylic acid, 6-methoxy-;6-methoxyquinoline-4-carboxylicaci | | CAS: | 86-68-0 | | MF: | C11H9NO3 | | MW: | 203.19 | | EINECS: | 617-906-2 | | Product Categories: | Fluorescent;Quinoline | | Mol File: | 86-68-0.mol |  |
| | QUININIC ACID Chemical Properties |
| Melting point | 280°C (decompose) | | Boiling point | 341.49°C (rough estimate) | | density | 1.2621 (rough estimate) | | refractive index | 1.4950 (estimate) | | storage temp. | 2-8°C | | solubility | Solubility Slightly soluble in water, cold ethanol, ether | | pka | 5.53(at 25℃) | | form | crystals | | color | Pale yellow | | PH Range | Yellow I uorescent (4.0) to blue I uorescent (5.0) | | Merck | 14,8062 | | Major Application | Display device, antihypertensive food materials, nucleic acids, antimalarial agent, antimalerial agent | | InChI | InChI=1S/C11H9NO3/c1-15-7-2-3-10-9(6-7)8(11(13)14)4-5-12-10/h2-6H,1H3,(H,13,14) | | InChIKey | XXLFLUJXWKXUGS-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(OC)=CC=2)C(C(O)=O)=CC=1 | | CAS DataBase Reference | 86-68-0 |
| | QUININIC ACID Usage And Synthesis |
| Description | 6-Methoxy-4-quinolinecarboxylic Acid is a derivative of 4-quinolinecarboxylic acids, which is a potential antitumor (such as leukemia) and antiviral agent. It also has the potential to be used as immunosuppressive reagent as well as for the treatment of skin and epithelial diseases.
| | Sources | https://www.sigmaaldrich.com/catalog/product/aldrich/174823?lang=en®ion=US
https://link.springer.com/article/10.1007/s11094-009-0187-1
https://patents.google.com/patent/US5084462A/en
https://patents.google.com/patent/US4861783A/en
| | Uses | 6-methoxyquinoline-4-carboxylic Acid is used in the preparation of tetrahydroisoquinoline amides as multidrug resistance reversers. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 11, p. 803, 1946 DOI: 10.1021/jo01176a024 |
| | QUININIC ACID Preparation Products And Raw materials |
|