N-(2-Hydroxyethyl)succinimide manufacturers
|
| | N-(2-Hydroxyethyl)succinimide Basic information |
| | N-(2-Hydroxyethyl)succinimide Chemical Properties |
| Melting point | 57-61 °C (lit.) | | Boiling point | 160-164 °C/3 mmHg (lit.) | | density | 1.3075 (rough estimate) | | refractive index | 1.4290 (estimate) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Sparingly) | | form | Solid | | pka | 14.20±0.10(Predicted) | | color | White to Off-White | | BRN | 124744 | | InChI | InChI=1S/C6H9NO3/c8-4-3-7-5(9)1-2-6(7)10/h8H,1-4H2 | | InChIKey | TWYIPMITVXPNEM-UHFFFAOYSA-N | | SMILES | N1(CCO)C(=O)CCC1=O | | CAS DataBase Reference | 18190-44-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933998090 |
| | N-(2-Hydroxyethyl)succinimide Usage And Synthesis |
| Synthesis | Succinimide (500 g; 5.0 mol), ethylene carbonate (444.34 g; 5.0 mol) and sodium carbonate (26.74 g; 0.25 mol) were mixed and slowly heated to 130C under stirring for 7 hours. The product was distilled via vacuum to yield N-(2-Hydroxyethyl)succinimide as a colourless substance. |
| | N-(2-Hydroxyethyl)succinimide Preparation Products And Raw materials |
|