|
|
| | (1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine Basic information |
| Product Name: | (1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine | | Synonyms: | (1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine, 99%, ee:99%;(1S,2S)-(-)-1,2-Diphenylethylenediamine ,99%;(1S,2S)-(-)-1,2-Diph;1S,2S-diphenylethane-1,2-diamine;(1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine ee;(1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine,99%,99% ee;((1S,2S)-2-AMino-1,2-diphenylethyl)aMine;(S,S)-1,2-DiaMino-1,2-diphenylethane | | CAS: | 29841-69-8 | | MF: | C14H16N2 | | MW: | 212.29 | | EINECS: | 608-420-1 | | Product Categories: | Synthetic Organic Chemistry;Amines and Derivatives;CHIRAL CHEMICALS;Chiral Compound;organic amine;Aromatics;Chiral reagent;CHIRAL COMPOUNDS;Amines (Chiral);Analytical Chemistry;Chiral Reagents;Miscellaneous Reagents;Chiral Nitrogen;DPEN Series;chiral;Asymmetric Synthesis;Chiral Building Blocks;e.e. / Absolute Configuration Determination (NMR);Enantiomer Excess & Absolute Configuration Determination;29841-69-8 | | Mol File: | 29841-69-8.mol |  |
| | (1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine Chemical Properties |
| Melting point | 83-85 °C(lit.) | | Boiling point | 342.14°C (rough estimate) | | alpha | -104 º (c=1.1, MeOH 25 ºC) | | density | 1.0799 (rough estimate) | | refractive index | -103 ° (C=1, EtOH) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 9.78±0.10(Predicted) | | form | crystal | | color | white to pale yellow | | Optical Rotation | [α]20/D 102°, c = 1 in ethanol | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | BRN | 3201645 | | InChI | 1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14-/m0/s1 | | InChIKey | PONXTPCRRASWKW-KBPBESRZSA-N | | SMILES | N[C@H]([C@@H](N)c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 29841-69-8(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34 | | Safety Statements | 26-36-45-36/37/39 | | RIDADR | UN3259 | | WGK Germany | 3 | | F | 10-23 | | HazardClass | 8 | | HS Code | 29213000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | (1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine solvation agent, For synthesis of enantiopure ethylenediamines by chirality transfer (condensation with diketones followed by reductive cleavage), Co-catalyst in the Ru catalyzed enantioselective hydrogenation of aromatic ketones, Versatile ligand for the formation of metal complexes.1 Used in the synthesis of chiral tropocoronands which have potential utility in asymmetric catalysis | | General Description | 1,2-Diphenylethylenediamine is a chiral molecule, generally used as a chiral resolving agent and as a precursor of the chiral auxiliary. It is also used as a chiral solvating agent in NMR study. | | Synthesis | The current preparation method is to split ()-1,2-diphenylethylenediamine under ethanol solvent with tartaric acid as the splitting agent, and according to the demand, the splitting is carried out by adopting different splitting conditions, so as to produce either (1S,2S)-1,2-diphenylethylenediamine or (1R,2R)- 1,2 -diphenylethylenediamine. |
| | (1S,2S)-(-)-1,2-Diphenyl-1,2-ethanediamine Preparation Products And Raw materials |
| Raw materials | Ethanol-->Acetic acid-->Acetic anhydride-->Hydrogen bromide-->Sodium acetate-->Sodium ethoxide-->Benzaldehyde-->Cyclohexanone-->Lithium-->L(+)-Tartaric acid-->Benzil-->N-Benzylideneamine-->(4R,5R)-2,4,5-triphenyl-4,5-dihydro-1H-imidazole-->(+/-)-1,2-DIPHENYLETHYLENEDIAMINE-->(1R,2R)-(+)-1,2-Diphenylethylenediamine-->(R,R)-(+)-HYDROBENZOIN | | Preparation Products | (1R,2R)-N,N'-DI-P-TOLUENESULFONYL-1,2-DIPHENYL-1,2-ETHYLENEDIAMINE-->1S,2S-N,N'-bis(phenylMethyl)-1,2-diphenyl-1,2-EthanediaMine |
|