|
|
| | 5-Bromothiazole-4-carboxylic acid Basic information |
| | 5-Bromothiazole-4-carboxylic acid Chemical Properties |
| Boiling point | 367.7±27.0 °C(Predicted) | | density | 2.062±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.17±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C4H2BrNO2S/c5-3-2(4(7)8)6-1-9-3/h1H,(H,7,8) | | InChIKey | AZYQIQWMHMYDPO-UHFFFAOYSA-N | | SMILES | S1C(Br)=C(C(O)=O)N=C1 |
| Hazard Codes | Xi | | HS Code | 2934100090 |
| | 5-Bromothiazole-4-carboxylic acid Usage And Synthesis |
| References | [1] Patent: WO2015/155549, 2015, A1. Location in patent: Page/Page column 152; 153 [2] Patent: WO2017/46603, 2017, A1. Location in patent: Page/Page column 138 |
| | 5-Bromothiazole-4-carboxylic acid Preparation Products And Raw materials |
|