|
|
| | 2-Chloro-3-methylpyridine Basic information |
| | 2-Chloro-3-methylpyridine Chemical Properties |
| Melting point | 193 °C | | Boiling point | 192-193 °C/751 mmHg (lit.) | | density | 1.17 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.533(lit.) | | Fp | 175 °F | | storage temp. | Inert atmosphere,Room Temperature | | pka | 0.75±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | Specific Gravity | 1.170 | | BRN | 107895 | | InChI | InChI=1S/C6H6ClN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 | | InChIKey | RKVUCIFREKHYTL-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC=C1C | | CAS DataBase Reference | 18368-76-8(CAS DataBase Reference) |
| | 2-Chloro-3-methylpyridine Usage And Synthesis |
| Description | 2-Chloro-3-methylpyridine is an intermediate for many medicines and pesticides, such as fluazifop, nicosulfuron, and fluazifop. Moreover, with the gradual promotion of these new high-efficiency and low-toxic heterocyclic pesticides, 2-chloro-3-methylpyridine is increasing. The industrial method for preparing 2-chloro-3-methylpyridine is to obtain it by site-specific chlorination of 3-methylpyridine. First, 3-methylpyridine is epoxidized and then chlorinated. The main chlorinated 3-methylpyridine is a mixture of 2-chloro-3-methylpyridine and 2-chloro-5-methylpyridine, of which 2-chloro-3-methylpyridine accounts for 20% (mass).
| | Chemical Properties | colorless to light yellow liquid | | Uses | 2-Chloro-3-methylpyridine is an active ingredient and a major constituent of imidaclopide, a systemic insecticide that acts as insect neurotoxin and belongs to a class of chemical called the neonicotinoids. |
| | 2-Chloro-3-methylpyridine Preparation Products And Raw materials |
|