| Company Name: |
Anhui Yongsheng Pharmaceutical Technology Co., Ltd Gold
|
| Tel: |
15021035486 18017383231 |
| Email: |
1849315414@qq.com |
| Products Intro: |
Product Name:3-(DIMETHYLAMINO)-1-(4-FLUOROPHENYL)-2-PROPEN-1-ONE
CAS:75175-77-8
Purity:98% Package:1kg；5kg;10kg；25kg；100kg
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:3-DiMethylaMino-1-(4-fluorophenyl)-2-propen-1-one, 97%
CAS:75175-77-8
Package:5g Remarks:H34021
|
|
| | 3-(DIMETHYLAMINO)-1-(4-FLUOROPHENYL)-2-PROPEN-1-ONE Basic information |
| Product Name: | 3-(DIMETHYLAMINO)-1-(4-FLUOROPHENYL)-2-PROPEN-1-ONE | | Synonyms: | 3-(DIMETHYLAMINO)-1-(4-FLUOROPHENYL)-2-PROPEN-1-ONE;2-Propen-1-one, 3-(diMethylaMino)-1-(4-fluorophenyl)-;3-(Dimethylamino)-1-(4-fluorophenyl)prop-2-en-1-one;(E)-3-dimethylamino-1-(4-fluorophenyl)prop-2-en-1-one;2-Propen-1-one, 1-(4-fluorophenyl)-3-dimethylamino-;Propenone, 1-(4-fluorophenyl)-3-dimethylamino-;(E)-3-Dimethylamino-1-(4-fluoro-phenyl)-propenone;3-(4-Fluorophenyl)-N,N-dimethylacrylamide | | CAS: | 75175-77-8 | | MF: | C11H12FNO | | MW: | 193.22 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-(DIMETHYLAMINO)-1-(4-FLUOROPHENYL)-2-PROPEN-1-ONE Chemical Properties |
| Melting point | 84-86° | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C11H12FNO/c1-13(2)8-7-11(14)9-3-5-10(12)6-4-9/h3-8H,1-2H3 | | InChIKey | GTJNUCRUOWBWEW-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(F)C=C1)(=O)C=CN(C)C | | CAS DataBase Reference | 75175-77-8 |
| HazardClass | IRRITANT | | HS Code | 2922390090 |
| | 3-(DIMETHYLAMINO)-1-(4-FLUOROPHENYL)-2-PROPEN-1-ONE Usage And Synthesis |
| | 3-(DIMETHYLAMINO)-1-(4-FLUOROPHENYL)-2-PROPEN-1-ONE Preparation Products And Raw materials |
|