|
|
| | 8-Hydroxyquinoline-5-sulfonic acid Basic information |
| | 8-Hydroxyquinoline-5-sulfonic acid Chemical Properties |
| Melting point | 311-313°C | | density | 1.4899 (rough estimate) | | refractive index | 1.5364 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | crystalline | | pka | pK1:4.092(＋1);pK2:8.776(0) (25°C) | | color | yellow to green | | Merck | 4844 | | Stability: | Hygroscopic | | InChI | InChI=1S/C9H7NO4S/c11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7/h1-5,11H,(H,12,13,14) | | InChIKey | LGDFHDKSYGVKDC-UHFFFAOYSA-N | | SMILES | N1C2C(=C(S(O)(=O)=O)C=CC=2O)C=CC=1 | | CAS DataBase Reference | 84-88-8(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Quinolinesulfonic acid, 8-hydroxy-(84-88-8) | | EPA Substance Registry System | 5-Quinolinesulfonic acid, 8-hydroxy- (84-88-8) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36-36/37/38 | | Safety Statements | 26-36 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | VC2570000 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29334990 |
| | 8-Hydroxyquinoline-5-sulfonic acid Usage And Synthesis |
| Chemical Properties | Yellow fine crystalline powder | | Uses | 8-Hydroxy-5-quinolinesulfonic acid is used in the synthesis of fat mass and obesity associated proteins. Also used in the synthesis of anti-schitosomal compounds. | | Purification Methods | Crystallise the acid from water (as the 1.5 hydrate, m 316-317o) or dilute HCl (ca 2% by weight). [Beilstein 22 I 620, 22 II 313, 22 III/IV 3493.] |
| | 8-Hydroxyquinoline-5-sulfonic acid Preparation Products And Raw materials |
|