Propionic acid hydrazide manufacturers
|
| | Propionic acid hydrazide Basic information |
| Product Name: | Propionic acid hydrazide | | Synonyms: | PROPIONIC ACID HYDRAZIDE;PROPIONOHYDRAZIDE;propanoicacid,hydrazide;propanoichydrazide;propiohydrazide;propionsaeurehydrazid;ART-CHEM-BB B015434;AKOS B015434 | | CAS: | 5818-15-5 | | MF: | C3H8N2O | | MW: | 88.11 | | EINECS: | 227-390-7 | | Product Categories: | | | Mol File: | 5818-15-5.mol |  |
| | Propionic acid hydrazide Chemical Properties |
| Melting point | 179-180 °C | | Boiling point | 243.3±9.0 °C(Predicted) | | density | 1.005±0.06 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | pka | 13.46±0.18(Predicted) | | Appearance | Colorless to light yellow Solid-Liquid Mixture | | InChI | InChI=1S/C3H8N2O/c1-2-3(6)5-4/h2,4H2,1H3,(H,5,6) | | InChIKey | DXGIRFAFSFKYCF-UHFFFAOYSA-N | | SMILES | C(NN)(=O)CC | | CAS DataBase Reference | 5818-15-5(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | UF4230000 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Propionic acid hydrazide Usage And Synthesis |
| Uses | Hydrazine propionate can be used as a pharmaceutical synthesis intermediate and can also be used to prepare a corrosion-resistant steel plate, including a steel plate and an anti-corrosion coating formed on the surface of the steel plate.
|
| | Propionic acid hydrazide Preparation Products And Raw materials |
|