|
|
| | Tetrachloroterephthalonitrile Basic information |
| Product Name: | Tetrachloroterephthalonitrile | | Synonyms: | tetrachloro-p-phthalodinitril;Tetrachloroterephthalonitrile,98%;Tetrachloro-terephthalodinitrile(TCTPN);Tetrachloro- terephthalodinitrile;1,4-Benzenedicarbonitrile, 2,3,5,6-tetrachloro-;TETRACHLOROTERTPHTHALONITRILE;1,4-Dicyano-2,3,5,6-tetra-chloro-benzene;2,3,5,6-Tetrachloro-1,4-benzenedicarbonitrile | | CAS: | 1897-41-2 | | MF: | C8Cl4N2 | | MW: | 265.91 | | EINECS: | 401-550-8 | | Product Categories: | C8 to C9;Cyanides/Nitriles;Nitrogen Compounds | | Mol File: | 1897-41-2.mol |  |
| | Tetrachloroterephthalonitrile Chemical Properties |
| Melting point | 308-312 °C(lit.) | | Boiling point | 370.1±42.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Methanol (Slightly) | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11 | | InChIKey | TXRVDQMSXQKAPG-UHFFFAOYSA-N | | SMILES | C1(C#N)=C(Cl)C(Cl)=C(C#N)C(Cl)=C1Cl | | CAS DataBase Reference | 1897-41-2(CAS DataBase Reference) |
| Hazard Codes | Xi,N | | Risk Statements | 43-53-50/53 | | Safety Statements | 24-37-61-60 | | RIDADR | 3077 | | WGK Germany | 1 | | RTECS | TI8275000 | | HS Code | 2926.90.4801 | | HazardClass | 9 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| | Tetrachloroterephthalonitrile Usage And Synthesis |
| Uses | Tetrachloroterephthalonitrile may be used to synthesize 2-aminotrifluoroterephthalonitriles. | | General Description | Tetrachloroterephthalonitrile (TCTPN), a dinitrile derivative, is an isomer of chloranil. The halogen bond of TCTPN has been studied using 35Cl solid-state NMR. |
| | Tetrachloroterephthalonitrile Preparation Products And Raw materials |
|