METRONIDAZOLE-D3 SOLUTION manufacturers
|
| | METRONIDAZOLE-D3 SOLUTION Basic information |
| Product Name: | METRONIDAZOLE-D3 SOLUTION | | Synonyms: | METRONIDAZOLE-D3 SOLUTION;Metronidazole-d3;2H3]-Metronidazole;Metronidazole-d3 (methyl-d3);1H-Imidazole-1-ethanol, 2-(methyl-d3)-5-nitro-;Metronidazole-D3 in Methanol;Lenacapavir Impurity 11;2-(Methyl-d3)-5-nitro-1H-imidazole-1-ethanol | | CAS: | 83413-09-6 | | MF: | C6H6D3N3O3 | | MW: | 174.17 | | EINECS: | | | Product Categories: | | | Mol File: | 83413-09-6.mol |  |
| | METRONIDAZOLE-D3 SOLUTION Chemical Properties |
| Melting point | 156-159°C | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C6H9N3O3/c1-5-7-4-6(9(11)12)8(5)2-3-10/h4,10H,2-3H2,1H3/i1D3 | | InChIKey | VAOCPAMSLUNLGC-FIBGUPNXSA-N | | SMILES | C(N1C(=NC=C1N(=O)=O)C([2H])([2H])[2H])CO |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| | METRONIDAZOLE-D3 SOLUTION Usage And Synthesis |
| Uses | Used as an antibacterial in the treatment of rosacea. Antiprotozoal (trichomonas). A potential human carcinogen. The deuterated from of Metronidazole (CAS# 443-48-1). |
| | METRONIDAZOLE-D3 SOLUTION Preparation Products And Raw materials |
|