|
| Estradiol-3-benzoate-17-butyrate Basic information |
Product Name: | Estradiol-3-benzoate-17-butyrate | Synonyms: | B-ESTRADIOL 3-BENZOATE 17-N-BUTYRATE;estra-1,3,5(10)-triene-3,17beta-diol 3-benzoate 17-butyrate;oestradiol benzoate 17-n-butyrate;Estra-1,3,5(10)-triene-3,17β-diol 3-benzoate 17-butanoate;Estra-1,3,5(10)-triene-3,17b-diol 3-benzoate 17-butyrate;Estradiol-3-benzoate-17-butyrate;Estradiol Benzoate Butyrate;17β-butyryloxy-3-benzoyloxy-estratriene-(A) | CAS: | 63042-18-2 | MF: | C29H34O4 | MW: | 446.58 | EINECS: | 263-807-9 | Product Categories: | APIs | Mol File: | 63042-18-2.mol |  |
| Estradiol-3-benzoate-17-butyrate Chemical Properties |
Melting point | 128.5-129.0 °C | Boiling point | 558.6±50.0 °C(Predicted) | density | 1.18±0.1 g/cm3(Predicted) | storage temp. | Sealed in dry,2-8°C | InChIKey | MKYFGNOOEKZNPW-PFQOISFUNA-N | SMILES | [C@@]12([H])CC[C@H](OC(=O)CCC)[C@@]1(C)CC[C@]1([H])C3C=CC(OC(=O)C4C=CC=CC=4)=CC=3CC[C@@]21[H] |&1:0,4,11,15,34,r| |
| Estradiol-3-benzoate-17-butyrate Usage And Synthesis |
| Estradiol-3-benzoate-17-butyrate Preparation Products And Raw materials |
|