| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N,N-BIS((S)-1-PHENYLETHYL) PHTHALAMIC ACID Basic information |
| | N,N-BIS((S)-1-PHENYLETHYL) PHTHALAMIC ACID Chemical Properties |
| Melting point | 100-110 °C(lit.) | | Boiling point | 582.2±50.0 °C(Predicted) | | density | 1.192±0.06 g/cm3(Predicted) | | pka | 3.35±0.36(Predicted) | | Optical Rotation | [α]22/D 153°, c = 1 in chloroform | | InChI | 1S/C24H23NO3/c1-17(19-11-5-3-6-12-19)25(18(2)20-13-7-4-8-14-20)23(26)21-15-9-10-16-22(21)24(27)28/h3-18H,1-2H3,(H,27,28)/t17-,18-/m0/s1 | | InChIKey | NCYIVOVUPRJYNJ-ROUUACIJSA-N | | SMILES | C[C@H](N([C@@H](C)c1ccccc1)C(=O)c2ccccc2C(O)=O)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N,N-BIS((S)-1-PHENYLETHYL) PHTHALAMIC ACID Usage And Synthesis |
| | N,N-BIS((S)-1-PHENYLETHYL) PHTHALAMIC ACID Preparation Products And Raw materials |
|