|
|
| | 1,4-Cyclohexanedione bis(ethylene ketal) Basic information |
| Product Name: | 1,4-Cyclohexanedione bis(ethylene ketal) | | Synonyms: | 1,4-Cyclohexanedione diethylene ketal;1,4-Cyclohexianedione bis(ethylene acetal);Dispiro[1,3-dioxolane-2,1'-cyclohexane-4',2''-[1,3]dioxolane];1,4-CYCLOHEXANEDIONE BISETHYLENE KETAL F;1,4,9,12-TETRAOXADISPIRO[4.2.4.2]TETRADECANE;1,4-CYCLOHEXANEDIONE BIS(ETHYLENE ACETAL);1,4-CYCLOHEXANEDIONE BIS(ETHYLENEKETAL);1,4,9,12-tetraoxadispiro[4.2.4^{8}.2^{5}]tetradecane | | CAS: | 183-97-1 | | MF: | C10H16O4 | | MW: | 200.23 | | EINECS: | | | Product Categories: | Dioxanes & Dioxolanes;Dioxolanes;Acetals/Ketals/Ortho Esters;Building Blocks;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds | | Mol File: | 183-97-1.mol |  |
| | 1,4-Cyclohexanedione bis(ethylene ketal) Chemical Properties |
| Melting point | 79-80 °C (lit.) | | Boiling point | 75-85 °C/0.5 mmHg (lit.) | | density | 1.1508 (rough estimate) | | refractive index | 1.4459 (estimate) | | Fp | 75-85°C/0.5mm | | storage temp. | Store below +30°C. | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C10H16O4/c1-2-10(13-7-8-14-10)4-3-9(1)11-5-6-12-9/h1-8H2 | | InChIKey | YSMVSEYPOBXSOK-UHFFFAOYSA-N | | SMILES | O1C2(CCC3(OCCO3)CC2)OCC1 | | CAS DataBase Reference | 183-97-1(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Cyclohexanedione bis(ethylene ketal)(183-97-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29329990 |
| | 1,4-Cyclohexanedione bis(ethylene ketal) Usage And Synthesis |
| General Description | Hydrolysis of 1,4-cyclohexanedione bis(ethylene ketal) at 250°C has been reported. | | Synthesis | After mixing 2243 g (20 mol) of 1,4-cyclohexanedione, 2607 g (42 mol) of ethylene glycol, the resin filtered, and 26 L of toluene, the temperature was raised slowly and refluxed for 11 hours to separate the water. The reaction temperature was lowered to 40° C., the resin was filtered, and the organic phase was concentrated until no liquid flowed. Then add 1257g (21mol) of methylboronic acid and 20L of n-heptane, raise the temperature to 80°C and react for 6 hours, then slowly cool down to 5-10°C in a gradient, filter, rinse the filter cake with n-heptane, and dry to obtain 1,4-Cyclohexanedione bis(ethylene ketal).
 |
| | 1,4-Cyclohexanedione bis(ethylene ketal) Preparation Products And Raw materials |
|