- ETHYL 4-PYRIDYLACETATE
-
- $1.10 / 1g
-
2025-11-18
- CAS:54401-85-3
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- ETHYL 4-PYRIDYLACETATE
-
- $1.00 / 1kg
-
2019-07-06
- CAS:54401-85-3
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: as request
|
| | ETHYL 4-PYRIDYLACETATE Basic information |
| | ETHYL 4-PYRIDYLACETATE Chemical Properties |
| Melting point | 18-19 °C (lit.) | | Boiling point | 127-128 °C/14 mmHg (lit.) | | density | 1.079 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.499(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | pka | 5.33±0.10(Predicted) | | Appearance | Colorless to off-white <18°C Solid,>19°C Liquid | | BRN | 123786 | | InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-8-3-5-10-6-4-8/h3-6H,2,7H2,1H3 | | InChIKey | QVLJLWHOILVHJJ-UHFFFAOYSA-N | | SMILES | C1=NC=CC(CC(OCC)=O)=C1 | | CAS DataBase Reference | 54401-85-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29333999 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | ETHYL 4-PYRIDYLACETATE Usage And Synthesis |
| Uses | Ethyl 4-pyridylacetate is a pyridine-based compound used for the grafting onto the self-adhesive gold substrates.
It may be used for the the following:
- As a starting material in the synthesis of 4-piperidylethanol.
- As a reactant in the synthesis of 4-(pyridyl) isosteres of meperidine.
- As a starting material in the synthesis of ethyl-4-piperidylacetate.
| | Uses | Ethyl 4-Pyridylacetate shows potential ability as an anticonvulsant and also exhibits neuropathic pain-attenuating properties. | | General Description | Ethyl 4-pyridylacetate is an ethyl ester of 4-pyridyl acetic acid. Its hydrochloride salt was used to prepare the starting material required for the synthesis of 2,2-dideutero-1-azabicyclo(2,2,2)-octane. It participates as a reagent in the synthesis of triarylethane phosphodiesterase 4 inhibitors. |
| | ETHYL 4-PYRIDYLACETATE Preparation Products And Raw materials |
|