- Tetrabutylurea
-
-
2026-05-04
- CAS:4559-86-8
- Min. Order:
- Purity: 0.99
- Supply Ability:
- Tetrabutylurea
-
- $10.00 / 1KG
-
2026-03-20
- CAS:4559-86-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Tetrabutylurea
-
- $1.00 / 1KG
-
2025-12-12
- CAS:4559-86-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
|
| | Tetrabutylurea Basic information |
| Product Name: | Tetrabutylurea | | Synonyms: | TETRA-N-BUTYLUREA;N,N,N',N'-TETRABUTYLUREA;1,1,3,3-tetrabutyl-ure;tetrabutyl-ure;Tetra Butyl Ureas ( TBU );1,1,3,3-TETRABUTYLUREA;Tertabutylurea;Urea, tetrabutyl- | | CAS: | 4559-86-8 | | MF: | C17H36N2O | | MW: | 284.48 | | EINECS: | 224-929-8 | | Product Categories: | Phosgene Derivatives | | Mol File: | 4559-86-8.mol |  |
| | Tetrabutylurea Chemical Properties |
| Melting point | -60 °C | | Boiling point | 163 °C / 12mmHg | | density | 0.88 | | vapor pressure | 0.019Pa at 20℃ | | refractive index | 1.4520-1.4560 | | Fp | 93 °C | | storage temp. | Store at room temperature | | form | clear liquid | | pka | -0.61±0.70(Predicted) | | color | Colorless to Light yellow to Light orange | | Water Solubility | 4.3mg/L at 20℃ | | InChI | InChI=1S/C17H36N2O/c1-5-9-13-18(14-10-6-2)17(20)19(15-11-7-3)16-12-8-4/h5-16H2,1-4H3 | | InChIKey | SNDGLCYYBKJSOT-UHFFFAOYSA-N | | SMILES | N(CCCC)(CCCC)C(N(CCCC)CCCC)=O | | LogP | 6.2 at 25℃ | | CAS DataBase Reference | 4559-86-8(CAS DataBase Reference) | | NIST Chemistry Reference | Urea, tetrabutyl-(4559-86-8) | | EPA Substance Registry System | Urea, tetrabutyl- (4559-86-8) |
| Safety Statements | 22-24/25 | | RTECS | YU2080000 | | TSCA | TSCA listed | | HS Code | 2924.19.8000 | | Toxicity | rat,LCLo,inhalation,700mg/m3/4H (700mg/m3),Food and Chemical Toxicology. Vol. 25, Pg. 173, 1987. |
| Provider | Language |
|
ALFA
| English |
| | Tetrabutylurea Usage And Synthesis |
| Chemical Properties | Liquid. Insoluble in water. Combustible. | | Uses | Plasticizer. |
| | Tetrabutylurea Preparation Products And Raw materials |
|