|
|
| | N,N-Dimethylaminomethylferrocene Basic information |
| | N,N-Dimethylaminomethylferrocene Chemical Properties |
| Melting point | 65 °C | | Boiling point | 124-128 °C2.5 mm Hg(lit.) | | density | 1.228 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.59(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Difficult to mix. | | form | liquid | | color | amber | | InChI | InChI=1S/C8H12N.C5H5.Fe/c1-9(2)7-8-5-3-4-6-8;1-2-4-5-3-1;/h3-6H,7H2,1-2H3;1-5H; | | InChIKey | JJJSTEANRWLZBH-UHFFFAOYSA-N | | SMILES | [C]1(CN(C)C)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,5,6,7,8,9,10,11,12,13| | | CAS DataBase Reference | 1271-86-9 | | EPA Substance Registry System | Ferrocene, [(dimethylamino)methyl]- (1271-86-9) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids |
| | N,N-Dimethylaminomethylferrocene Usage And Synthesis |
| Chemical Properties | Brown to dark brown liquid | | Uses | (Dimethylaminomethyl)ferrocene is used as an active pharmaceutical ingredient. | | reaction suitability | core: iron reagent type: catalyst |
| | N,N-Dimethylaminomethylferrocene Preparation Products And Raw materials |
|