|
|
| | 5-Bromo-7-nitroindoline Basic information |
| | 5-Bromo-7-nitroindoline Chemical Properties |
| Melting point | 133-136°C | | Boiling point | 344.2±42.0 °C(Predicted) | | density | 1.704±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | pka | -1.87±0.20(Predicted) | | Appearance | Orange to red Solid | | Water Solubility | Insoluble in water. | | BRN | 1373199 | | InChI | InChI=1S/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 | | InChIKey | VXKXMHDXFLFIFI-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Br)C=C2[N+]([O-])=O)CC1 | | CAS DataBase Reference | 80166-90-1(CAS DataBase Reference) |
| | 5-Bromo-7-nitroindoline Usage And Synthesis |
| Chemical Properties | Orange to brown solid | | Uses | 5-Bromo-7-nitroindoline is used as pharmaceuticals and intermediates. |
| | 5-Bromo-7-nitroindoline Preparation Products And Raw materials |
|