|
|
| | 2,4-Dichloro-1,3,5-triazine Basic information |
| Product Name: | 2,4-Dichloro-1,3,5-triazine | | Synonyms: | 2,4-DICHLORO-1,3,5-TRIAZINE;2,4-dichlorotriazine;2,4-Dichloro-s-triazine;1,3,5-Triazine,2,4-dichloro-;2,4-Dichloro-1,3,5-triazine>;oro-1,3,5-triazine;2,4-Dichloro-1,3,5-Triazine pure, 98%;Dichloro-s-triazine | | CAS: | 2831-66-5 | | MF: | C3HCl2N3 | | MW: | 149.97 | | EINECS: | 676-236-9 | | Product Categories: | alkyl chloride;Heterocycles | | Mol File: | 2831-66-5.mol |  |
| | 2,4-Dichloro-1,3,5-triazine Chemical Properties |
| Melting point | 54.0 to 58.0 °C | | Boiling point | 102°C/75mmHg(lit.) | | density | 1.612±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | -1.24±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C3HCl2N3/c4-2-6-1-7-3(5)8-2/h1H | | InChIKey | OMRXVBREYFZQHU-UHFFFAOYSA-N | | SMILES | N1=CN=C(Cl)N=C1Cl | | CAS DataBase Reference | 2831-66-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | HazardClass | IRRITANT | | HS Code | 2933698090 |
| | 2,4-Dichloro-1,3,5-triazine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2,4-Dichloro-1,3,5-triazine is used as an intermediate in organic synthesis and pharmaceutical intermediates, and it is an intermediate in the preparation of bromhexine impurities. | | Preparation | 2,4-Dichloro-1,3,5-triazine can be synthesized by halogenation of 1,3,5-Triazine with chlorine. |
| | 2,4-Dichloro-1,3,5-triazine Preparation Products And Raw materials |
|