4-(PHENYLAZO)DIPHENYLAMINE manufacturers
|
| | 4-(PHENYLAZO)DIPHENYLAMINE Basic information |
| | 4-(PHENYLAZO)DIPHENYLAMINE Chemical Properties |
| Melting point | 87-91 °C | | Boiling point | 406.35°C (rough estimate) | | density | 1.0332 (rough estimate) | | refractive index | 1.5480 (estimate) | | storage temp. | room temp | | solubility | Solubility Insoluble in water; soluble in ethanol, methanol | | pka | 0.42(at 25℃) | | form | Fine Crystalline Powder | | color | Orange | | PH Range | Red (1.2) to yellow (2.5) | | λmax | 411nm, 272nm | | BRN | 749359 | | Major Application | Display device, nonlinear optial (NLO) material, photoresists, printing plates, lithographic plates, photosensitive materials, photography, markers | | InChI | InChI=1S/C18H15N3/c1-3-7-15(8-4-1)19-16-11-13-18(14-12-16)21-20-17-9-5-2-6-10-17/h1-14,19H | | InChIKey | VXLFYNFOITWQPM-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=CC=C2)=CC=C(N=NC2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 101-75-7(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, N-phenyl-4-(phenylazo)- (101-75-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3234 | | WGK Germany | 1 | | RTECS | JK0185000 | | TSCA | Yes | | HS Code | 29270000 | | Toxicity | LD50 ivn-mus: 56 mg/kg CSLNX* NX#03760 |
| | 4-(PHENYLAZO)DIPHENYLAMINE Usage And Synthesis |
| Chemical Properties | orange fine crystalline powder | | Uses | 4-(Phenylazo)diphenylamine is a soluble azo dye and stain. Dyes and metabolites. | | Safety Profile | Poison by intravenous route. When heated to decomposition it emits toxic vapors of NOx. | | Purification Methods | Purify the dye by chromatography on neutral alumina using dry *C6H6 with 1% of dry MeOH. The major component, which gave a stationary band, is cut out and eluted with EtOH or MeOH. [H.gfeldt & Bigeleisen J Am Chem Soc 82 15 1960.] It crystallises from pet ether, EtOH or aqueous EtOH, and has max at 420nm ( 28,000) (aqueous EtOH) and 540nm (aqueous EtOH/H2SO4) [Badger et al. J Chem Soc 1888 1954, Beilstein 16 H 314, 16 III 343, 16 IV 457.] |
| | 4-(PHENYLAZO)DIPHENYLAMINE Preparation Products And Raw materials |
|