Bromoxylenol Blue manufacturers
- Bromoxylenol Blue
-
- $1.00 / 1KG
-
2020-01-10
- CAS:40070-59-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | Bromoxylenol Blue Basic information |
| Product Name: | Bromoxylenol Blue | | Synonyms: | BROMOXYLENOL BLUE;3',3''-DIBROMO-P-XYLENOLSULFONEPHTHALEIN;3',3''-DIBROMO-P-XYLENOLSULFONPHTHALEIN;Bromoxylenol;4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[3-bromo-2,5-dimethylphenol] S,S-dioxide;BROMXYLENOL BLUE;BROMOXYLENOL BLUE, INDICATOR GRADE;3,3'-Dibromo-p-xylenolsulfonphthaleine | | CAS: | 40070-59-5 | | MF: | C23H20Br2O5S | | MW: | 568.27 | | EINECS: | 254-780-4 | | Product Categories: | Sulfonephthalein | | Mol File: | 40070-59-5.mol |  |
| | Bromoxylenol Blue Chemical Properties |
| Melting point | 218 °C (dec.)(lit.) | | Boiling point | 642.8±55.0 °C(Predicted) | | density | 1.684±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | Slightly soluble in water, ethanol; soluble in ethyl acetate | | pka | 7.0(at 25℃) | | form | Crystalline Powder | | color | Purple | | PH Range | 5.7(yellow)-7.5(blue) | | PH | 6.0-7.6, yellow to blue | | ε(extinction coefficient) | ≥16000 at 417-421nm in methanol at 0.016g/L | | λmax | 417nm | | BRN | 369060 | | Major Application | Optical lenses, sol-gel matrix, inks, paints, toys, lubricants, cosmetics, food storage, microorganism detector, determination of drugs, diagnosis of multiple diseases | | InChI | 1S/C23H20Br2O5S/c1-11-9-16(13(3)19(24)21(11)26)23(17-10-12(2)22(27)20(25)14(17)4)15-7-5-6-8-18(15)31(28,29)30-23/h5-10,26-27H,1-4H3 | | InChIKey | MRDOFVRMTNWMDA-UHFFFAOYSA-N | | SMILES | Cc1cc(c(C)c(Br)c1O)C2(OS(=O)(=O)c3ccccc23)c4cc(C)c(O)c(Br)c4C | | CAS DataBase Reference | 40070-59-5 |
| | Bromoxylenol Blue Usage And Synthesis |
| Chemical Properties | purple crystalline powder | | Uses | Bromoxylenol Blue (CAS# 40070-59-5) is an organic dye used in the preparation of colorimetric sensor arrays for lung cancer screening. Dyes and metabolites. |
| | Bromoxylenol Blue Preparation Products And Raw materials |
|