|
|
| | Sodium hydroxymethylglycinate Basic information |
| Product Name: | Sodium hydroxymethylglycinate | | Synonyms: | N-(Hydroxymethyl)glycine monosodium salt;Glycine, N-(hydroxymethyl)-, monosodium salt;sodium hydroxymethylamino acetate;N-(Hydroxymethyl)glycine sodium salt;Sodium 2-((hydroxymethyl)amino)acetate;Glycine,N-(hydroxymethyl)-, sodium salt (1:1);Sodium 2-((hydroxymethyl);Sodium hydroxymethyl | | CAS: | 70161-44-3 | | MF: | C3H8NNaO3 | | MW: | 129.09 | | EINECS: | 274-357-8 | | Product Categories: | pharmacetical;70161-44-3 | | Mol File: | 70161-44-3.mol |  |
| | Sodium hydroxymethylglycinate Chemical Properties |
| density | 1.653[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid | | color | Colorless to light yellow | | Water Solubility | 500g/L at 20℃ | | Stability: | Stability Incompatible with strong oxidizing agents. | | Cosmetics Ingredients Functions | PRESERVATIVE
HAIR CONDITIONING | | InChI | InChI=1S/C3H7NO3.Na.H/c5-2-4-1-3(6)7;;/h4-5H,1-2H2,(H,6,7);; | | InChIKey | QIOBDSHYFNLTBH-UHFFFAOYSA-N | | SMILES | C(NCO)C(=O)O.[NaH] | | LogP | -1.533 at 26℃ | | CAS DataBase Reference | 70161-44-3 | | EPA Substance Registry System | Sodium hydroxymethylamino acetate (70161-44-3) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2 |
| | Sodium hydroxymethylglycinate Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid | | Uses | It is reporthed that Sodium (Hydroxymethyl)glycinate is a formaldehyde releaser which is used in industrial and consumer products such as cosmetics and other skin care products which causes dermatitis in humans. | | Uses | sodium hydroxymethyl glycinate is an anti-microbial. It is derived from glycine, a naturally occurring amino acid and is used as a preservative in cosmetics. |
| | Sodium hydroxymethylglycinate Preparation Products And Raw materials |
|