- 1, 1,3-Tribromoacetone
-
- $30.00 / 1kg
-
2025-03-04
- CAS:3475-39-6
- Min. Order: 1kg
- Purity: 90%
- Supply Ability: 2000kg
- 1,1,3-Tribromoacetone
-
- $9.80 / 1KG
-
2024-08-02
- CAS:3475-39-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- 1,1,3-Tribromoacetone
-
- $0.00 / 1kg
-
2024-04-16
- CAS:3475-39-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000kg
|
| | 1,1,3-Tribromoacetone Basic information |
| Product Name: | 1,1,3-Tribromoacetone | | Synonyms: | 1,1,3-TribromoAceton;1,1,3-tribromoacetone;1,1,3-Tribromopropan-2-one;2-Propanone,1,1,3-tribromo-;JACS-3475-39-6;TIANFU-CHEM--1,1,3-Tribromoacetone;1,1,3-Tribromo-2-propanone | | CAS: | 3475-39-6 | | MF: | C3H3Br3O | | MW: | 294.77 | | EINECS: | | | Product Categories: | | | Mol File: | 3475-39-6.mol |  |
| | 1,1,3-Tribromoacetone Chemical Properties |
| Melting point | 28-29 °C | | Boiling point | 114-116 °C(Press: 14 Torr) | | density | 2.561±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 100 mg/mL (339.25 mM; Need ultrasonic) | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C3H3Br3O/c4-1-2(7)3(5)6/h3H,1H2 | | InChIKey | FNYCCOFOQIUTIM-UHFFFAOYSA-N | | SMILES | C(Br)(Br)C(=O)CBr |
| | 1,1,3-Tribromoacetone Usage And Synthesis |
| Chemical Properties | White or light yellow solid | | Uses | 1,1,3-Tribromoacetone is an impurity of Methotrexate (HY-14519). Methotrexate, an antimetabolite and antifolate agent, inhibits the enzyme dihydrofolate reductase, thereby preventing the conversion of folic acid into tetrahydrofolate, and inhibiting DNA synthesis.
|
| | 1,1,3-Tribromoacetone Preparation Products And Raw materials |
|