| Company Name: |
Nanjing Chemlin Chemical Co., Ltd
|
| Tel: |
025-83697070 13770331960 |
| Email: |
info@chemlin.com.cn |
| Products Intro: |
Product Name:4-Hydroxy-7-methyl-1,8-naphthyridine-3-carboxylic acid ethyl ester
CAS:13250-96-9
Purity:0.98 Package:5KG; 1KG; 10g; 100g; 500g
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:Ethyl 4-hydroxy-7-methyl-1,8-naphthyridine-3-carboxylate
CAS:13250-96-9
Purity:95% Package:100mg;250mg;1g;5g Remarks:BD18040
|
|
| | ethyl 4-hydroxy-7-methyl-1,8-naphthyridine-3-carboxylate Basic information |
| Product Name: | ethyl 4-hydroxy-7-methyl-1,8-naphthyridine-3-carboxylate | | Synonyms: | ethyl 4-hydroxy-7-methyl-1,8-naphthyridine-3-carboxylate;4-Hydroxy-7-methyl-1,8-naphthyridine-3-carboxylic acid ethyl ester;Einecs 236-234-7;7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid ethyl ester;ethyl 7-methyl-4-oxo-1H-1,8-naphthyridine-3-carboxylate;1,8-Naphthyridine-3-carboxylic acid, 4-hydroxy-7-methyl-, ethyl ester;Nalidixic Acid EP Impurity B;4-hydroxy-7-methyl-1,8-naphthalenedine-3-carboxylic acidethyl ester | | CAS: | 13250-96-9 | | MF: | C12H12N2O3 | | MW: | 232.24 | | EINECS: | 2362347 | | Product Categories: | | | Mol File: | 13250-96-9.mol |  |
| | ethyl 4-hydroxy-7-methyl-1,8-naphthyridine-3-carboxylate Chemical Properties |
| Melting point | 272-273 °C | | Boiling point | 350.5±37.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 2.83±0.50(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C12H12N2O3/c1-3-17-12(16)9-6-13-11-8(10(9)15)5-4-7(2)14-11/h4-6H,3H2,1-2H3,(H,13,14,15) | | InChIKey | KPXWNJGVBKCXKB-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(C)N=2)C(O)=C(C(OCC)=O)C=1 |
| | ethyl 4-hydroxy-7-methyl-1,8-naphthyridine-3-carboxylate Usage And Synthesis |
| Uses | Ethyl 4-Hydroxy-7-methyl-1,8-naphthyridine-3-carboxylate is a reagent used in the synthesis of flavoquinolones which may display antibacterial activity | | Synthesis Reference(s) | Journal of the American Chemical Society, 70, p. 3348, 1948 DOI: 10.1021/ja01190a038 |
| | ethyl 4-hydroxy-7-methyl-1,8-naphthyridine-3-carboxylate Preparation Products And Raw materials |
|