2-acetamido-2-deoxy-D-mannose manufacturers
- N-Acetyl-D-mannosamine
-
- $0.00 / 25kg
-
2023-06-25
- CAS:3615-17-6
- Min. Order: 1kg
- Purity: 98.0%HPLC,Enterprise standard
- Supply Ability: 20t
|
| | 2-acetamido-2-deoxy-D-mannose Basic information |
| Product Name: | 2-acetamido-2-deoxy-D-mannose | | Synonyms: | D-Mannose, 2-(acetylamino)-2-deoxy-;N-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide;2-(Acetylamino)-2-deoxy-D-mannose;2-Acetylamino-2-deoxy-D-mannose;N-Acetyl-D-mannosamine, 2-(Acetylamino)-2-deoxy-D-mannopyranose;N-Acetyl-D-mannosamine Monohydrate;N-((2S,3R,4S,5R)-3,4,5,6-Tetrahydroxy-1-oxohexan-2-yl)acetamide;2-Acetamido-2-deoxy-D-mannopyranose,
N-acetyl-D-mannosamine | | CAS: | 3615-17-6 | | MF: | C8H15NO6 | | MW: | 221.21 | | EINECS: | 222-790-8 | | Product Categories: | Carbohydrates & Derivatives;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals;Biochemistry;Sugars | | Mol File: | 3615-17-6.mol |  |
| | 2-acetamido-2-deoxy-D-mannose Chemical Properties |
| Melting point | 205 °C | | Boiling point | 636.4±55.0 °C(Predicted) | | density | 1.423±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble (water) | | form | powder to crystal | | pka | 13.04±0.20(Predicted) | | color | White to Almost white | | Optical Rotation | -9.4 → +9.7 | | InChI | InChI=1S/C8H15NO6/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11/h2,5-8,11,13-15H,3H2,1H3,(H,9,12)/t5-,6-,7-,8-/m1/s1 | | InChIKey | MBLBDJOUHNCFQT-WCTZXXKLSA-N | | SMILES | [C@H](C=O)(NC(=O)C)[C@@H](O)[C@H](O)[C@H](O)CO |
| | 2-acetamido-2-deoxy-D-mannose Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A derivative of D-Mannosamine (M167000). | | Definition | ChEBI: An N-acetylmannosamine having D-configuration. |
| | 2-acetamido-2-deoxy-D-mannose Preparation Products And Raw materials |
|