| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid manufacturers
- Piperic acid
-
- $1520.00
-
2026-05-11
- CAS:5285-18-7
- Purity:
- Supply Ability: 10g
|
| | 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid Basic information |
| | 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid Chemical Properties |
| Melting point | 215°C | | Boiling point | 318.88°C (rough estimate) | | density | 1.2655 (rough estimate) | | refractive index | 1.7160 (estimate) | | form | solid | | InChI | 1S/C12H10O4/c13-12(14)4-2-1-3-9-5-6-10-11(7-9)16-8-15-10/h1-7H,8H2,(H,13,14)/b3-1+,4-2+ | | InChIKey | RHBGITBPARBDPH-ZPUQHVIOSA-N | | SMILES | OC(=O)\C=C\C=C\c1ccc2OCOc2c1 |
| Hazard Codes | Xn | | Risk Statements | 22-52/53 | | Safety Statements | 61 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid Usage And Synthesis |
| Uses | Piperic acid is a natural antioxidant and antibacterial agent. Piperic acid can be used in food preservation and human health[1]. | | References | [1] Zarai Z, et al. Antioxidant and antimicrobial activities of various solvent extracts, piperine and piperic acid from Piper nigrum[J]. Lwt-Food science and technology, 2013, 50(2): 634-641. |
| | 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid Preparation Products And Raw materials |
|