|
|
| | N-Boc-4-piperidinemethanol Basic information |
| | N-Boc-4-piperidinemethanol Chemical Properties |
| Melting point | 78-82 °C (lit.) | | Boiling point | 308.0±15.0 °C(Predicted) | | density | 1.059±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Powder | | pka | 14.94±0.10(Predicted) | | color | White to brown | | InChI | InChI=1S/C11H21NO3/c1-11(2,3)15-10(14)12-6-4-9(8-13)5-7-12/h9,13H,4-8H2,1-3H3 | | InChIKey | CTEDVGRUGMPBHE-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(CO)CC1 | | CAS DataBase Reference | 123855-51-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 |
| | N-Boc-4-piperidinemethanol Usage And Synthesis |
| Chemical Properties | White to light brown solid | | Uses | N-Boc-4-piperidinemethanol is an important piperidine derivative, which can be used in organic synthesis and pharmaceutical intermediates, It may be used to synthesize:
methyl 5-methoxy-4-(1-methylpiperidin-4-ylmethoxy)-2-nitrobenzoate
N-Boc-4-piperidinecarboxaldehyde
[1-(tert-butoxycarbonyl)piperidin-4-yl]methyl methanesulfonate
Involved in the synthesis of bradycardic agents. | | Application | N-Boc-4-piperidinemethanol is a curcumin analogue that binds to the epidermal growth factor receptor (EGFR) and prevents the binding of ligands. In vitro studies have shown that it can inhibit tumor growth and induce apoptosis in cancer cells. The drug is also capable of inhibiting the proliferation of normal cells, which may be due to its ability to recruit EGFR from outside the cell membrane. This process triggers signaling events that lead to cell death. | | General Description | N-Boc-4-piperidinemethanol contains a tert-butyloxycarbonyl (t-BOC)-protecting group. It can be synthesized from 4-piperidinemethanol via reaction with di-tert-butyldicarbonate. |
| | N-Boc-4-piperidinemethanol Preparation Products And Raw materials |
|