|
| 2-Chlorophenoxyacetic acid Basic information |
| 2-Chlorophenoxyacetic acid Chemical Properties |
Melting point | 144-148 °C | Boiling point | 266.91°C (rough estimate) | density | 1.3245 (rough estimate) | refractive index | 1.5250 (estimate) | form | powder to crystal | pka | 3.05(at 25℃) | color | White to Almost white | Water Solubility | 1.278g/L(25 ºC) | BRN | 1103151 | InChI | InChI=1S/C8H7ClO3/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4H,5H2,(H,10,11) | InChIKey | OPQYFNRLWBWCST-UHFFFAOYSA-N | SMILES | C(O)(=O)COC1=CC=CC=C1Cl | CAS DataBase Reference | 614-61-9(CAS DataBase Reference) | NIST Chemistry Reference | (2-Chlorophenoxy)acetic acid(614-61-9) |
| 2-Chlorophenoxyacetic acid Usage And Synthesis |
Chemical Properties | white powder |
| 2-Chlorophenoxyacetic acid Preparation Products And Raw materials |
|