| Company Name: |
NovoChemy Ltd.
|
| Tel: |
021-31261262/ 49 (0)17662837245 |
| Email: |
sales@novochemy.com |
| Products Intro: |
Product Name:tert-Butyl (3-chloro-2-oxopropyl)carbaMate
CAS:137990-82-0
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-66028182 18626450290 |
| Email: |
yftan@aikonchem.com |
| Products Intro: |
Product Name:tert-Butyl (3-chloro-2-oxopropyl)carbamate
CAS:137990-82-0
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Jinan ponder chemical co. LTD
|
| Tel: |
0531-0000 |
| Email: |
thinklifescience@163.com |
| Products Intro: |
Product Name:137990-82-0
CAS:137990-82-0
Purity:99% HPLC Package:1KG;500G;100G；50G;1G
|
|
| | Carbamic acid, (3-chloro-2-oxopropyl)-, 1,1-dimethylethyl ester (9CI) Basic information |
| Product Name: | Carbamic acid, (3-chloro-2-oxopropyl)-, 1,1-dimethylethyl ester (9CI) | | Synonyms: | Carbamic acid, (3-chloro-2-oxopropyl)-, 1,1-dimethylethyl ester (9CI);tert-Butyl (3-chloro-2-oxopropyl)carbaMate;CarbaMic acid, (3-chloro-2-oxopropyl)-, 1,1-diMethylethyl ester;Carbamic acid, N-(3-chloro-2-oxopropyl)-, 1,1-dimethylethyl ester;tertbutyl (3-chloro-2-oxopropyl)aminoformate;tert-butyl N-(3-chloro-2-oxo-propyl)carbamate;1-(Boc-amino)-3-chloro-2-propanone | | CAS: | 137990-82-0 | | MF: | C8H14ClNO3 | | MW: | 207.65 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 137990-82-0.mol |  |
| | Carbamic acid, (3-chloro-2-oxopropyl)-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Boiling point | 299.7±20.0 °C(Predicted) | | density | 1.144±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | pka | 10.76±0.46(Predicted) | | Appearance | Light yellow to yellow Solid |
| | Carbamic acid, (3-chloro-2-oxopropyl)-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| | Carbamic acid, (3-chloro-2-oxopropyl)-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|