- Topanol CA
-
- $31.00 / 5mg
-
2026-04-14
- CAS:1843-03-4
- Min. Order:
- Purity: 99.53%
- Supply Ability: 10g
|
| | 1,1,3-TRIS(2-METHYL-4-HYDROXY-5-TERT-BUTYLPHENYL)BUTANE Basic information |
| Product Name: | 1,1,3-TRIS(2-METHYL-4-HYDROXY-5-TERT-BUTYLPHENYL)BUTANE | | Synonyms: | 4-[1,3-bis(5-tert-butyl-4-hydroxy-2-methyl-phenyl)butyl]-2-tert-butyl-5-methyl-phenol;4-[1,3-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-2-tert-butyl-5-methylphenol;Tri Phenyl Methyl Butane (TPMB);1,1,3-Tris-(2-tert-butyl-4-hydroxy-5-Methylphenyl)-butane (TPMB);1,1,3-Tri(4-hydroxy-2-methyl-5-tert-butylphenyl)butane;Lowinox CA 22;Mixxim AO 30;OS 930 | | CAS: | 1843-03-4 | | MF: | C37H52O3 | | MW: | 544.81 | | EINECS: | 217-420-7 | | Product Categories: | Organics;Industrial/Fine Chemicals | | Mol File: | 1843-03-4.mol |  |
| | 1,1,3-TRIS(2-METHYL-4-HYDROXY-5-TERT-BUTYLPHENYL)BUTANE Chemical Properties |
| Melting point | 183-190 °C(lit.) | | Boiling point | 578.54°C (rough estimate) | | density | 0.5g/cm3 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.5800 (estimate) | | Fp | 225 °F | | pka | 10.38±0.20(Predicted) | | Water Solubility | 0.02ng/L at 20℃ | | Cosmetics Ingredients Functions | PLASTICISER SOLVENT FILM FORMING | | InChIKey | PRWJPWSKLXYEPD-UHFFFAOYSA-N | | SMILES | C(C1=C(C)C=C(O)C(C(C)(C)C)=C1)(C)CC(C1=C(C)C=C(O)C(C(C)(C)C)=C1)C1=C(C)C=C(O)C(C(C)(C)C)=C1 | | LogP | 12.7 at 25℃ | | CAS DataBase Reference | 1843-03-4(CAS DataBase Reference) | | EPA Substance Registry System | 1,1,3-Tris(2-methyl-4-hydroxy-5-tert-butylphenyl)butane (1843-03-4) |
| WGK Germany | 1 | | RTECS | SM1157000 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 1,1,3-TRIS(2-METHYL-4-HYDROXY-5-TERT-BUTYLPHENYL)BUTANE Usage And Synthesis |
| Chemical Properties | 1,1,3-Tris(2-Methyl-4-hydroxy-5-tert-butylphenyl)butane is a white crystalline powder.
| | Uses | 1,1,3-Tris(2-Methyl-4-hydroxy-5-tert-butylphenyl)butane is an excellent phenolic antioxidant and can be used as a stabilizer in polypropylene, polyethylene, polyvinyl chloride, ABS, polyoxymethylene and other resins and light-colored rubber products. It works synergistically with the antioxidant DLTP. | | Flammability and Explosibility | Non flammable |
| | 1,1,3-TRIS(2-METHYL-4-HYDROXY-5-TERT-BUTYLPHENYL)BUTANE Preparation Products And Raw materials |
|