|
|
| | Sodium nitroprusside dihydrate Basic information |
| | Sodium nitroprusside dihydrate Chemical Properties |
| density | 1.72 | | bulk density | 1000kg/m3 | | storage temp. | 2-8°C | | solubility | 400g/l (slow decomposition) | | form | Crystals | | color | Ruby red | | Specific Gravity | 1.72 | | PH | 5 (50g/l, H2O, 20℃) | | Water Solubility | Soluble in water. Slightly soluble ethanol. | | Sensitive | Hygroscopic | | Merck | 14,8649 | | Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 25 mg/m3; TWA 1 mg/m3 | | InChI | InChI=1S/5CN.Fe.NO.Na.H2O/c5*1-2;;1-2;;/h;;;;;;;;1H2/q5*-1;+2;2*+1; | | InChIKey | OIRZWVYIQXBRFC-UHFFFAOYSA-N | | SMILES | [Fe+2](N#[O+])([C-]#N)([C-]#N)([C-]#N)([C-]#N)[C-]#N.[Na+].O | | CAS DataBase Reference | 13755-38-9 |
| Hazard Codes | T,T+ | | Risk Statements | 25-26/27/28 | | Safety Statements | 45-36/37/39-22 | | RIDADR | UN 3288 6.1/PG 3 | | WGK Germany | 3 | | RTECS | LJ8925000 | | F | 3 | | TSCA | Yes | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 28372000 | | Toxicity | LD50 orally in Rabbit: 99 mg/kg |
| | Sodium nitroprusside dihydrate Usage And Synthesis |
| Chemical Properties | Bright red crystals | | Uses | Reagent for the analysis of zinc, sulphide, sulphur dioxide, acetone and organic compounds. | | Uses | Sodium nitroferricyanide(III) dihydrate is a reagent for the detection of many organic Compounds, e.g., acetone, aldehydes, also of alkali sulfides, zinc, SO2. | | Uses | anthelmintic | | Uses | Used in medicine hypertensive emergency. | | Definition | ChEBI: A hydrate that is the dihydrate form of sodium nitroprusside. | | Brand name | Nipride (Roche); Nitropress (Abbott); Nitropress (Hospira). | | General Description | Certified pharmaceutical secondary standards for application in quality control provide pharma laboratories and manufacturers with a convenient and cost-effective alternative to pharmacopeia primary standards. Sodium Nitroprusside is widely used as a drug to manage hypertension, via lowering elevated blood pressure by acting on the arteriolar smooth muscle. | | reaction suitability | reagent type: catalyst core: iron |
| | Sodium nitroprusside dihydrate Preparation Products And Raw materials |
|