|
| 2-FLUORO-6-METHOXYPHENOL Basic information |
| 2-FLUORO-6-METHOXYPHENOL Chemical Properties |
Boiling point | 130-131 °C36 mm Hg(lit.) | density | 1.23 g/mL at 25 °C(lit.) | refractive index | n20/D 1.52(lit.) | Fp | 218 °F | storage temp. | Inert atmosphere,Room Temperature | pka | 8.71±0.10(Predicted) | form | Liquid | color | Clear colorless to light brown | Specific Gravity | 1.230 | InChI | InChI=1S/C7H7FO2/c1-10-6-4-2-3-5(8)7(6)9/h2-4,9H,1H3 | InChIKey | YZNHPLVFLRSVHY-UHFFFAOYSA-N | SMILES | C1(O)=C(OC)C=CC=C1F | CAS DataBase Reference | 73943-41-6(CAS DataBase Reference) |
Hazard Codes | Xi,C | Risk Statements | 36/37/38 | Safety Statements | 26-37/39 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29095000 |
| 2-FLUORO-6-METHOXYPHENOL Usage And Synthesis |
Chemical Properties | Clear colorless to light brown liquid |
| 2-FLUORO-6-METHOXYPHENOL Preparation Products And Raw materials |
|